1-[[oxo(3-pyridinyl)methyl]amino]-3-(4-propan-2-ylphenyl)thiourea

**1-[[Oxo(3-pyridinyl)methyl]amino]-3-(4-propan-2-ylphenyl)thiourea** is a chemical compound with the following structural formula:

```
O
||
N-C-CH2-NH-C(=S)-NH-C6H4-CH(CH3)2
|
3-pyridinyl
```

**Importance for Research:**

This compound has been investigated for its potential pharmacological activities, particularly its **anti-inflammatory and analgesic properties**.

**Here's why it's of research interest:**

* **Anti-inflammatory Activity:** Thiourea derivatives are known to exhibit anti-inflammatory effects. The presence of the 3-pyridinyl group and the propan-2-ylphenyl substituent in this molecule might enhance its anti-inflammatory potency.
* **Analgesic Activity:** Thioureas are also known to possess analgesic activity, which could be beneficial in pain management.
* **Structure-Activity Relationships:** This compound serves as a lead molecule for studying the structure-activity relationships of thiourea derivatives. Modifications to its structure could lead to the discovery of more potent and selective anti-inflammatory and analgesic agents.
* **Drug Development:** This molecule has the potential to be a starting point for the development of new drugs for treating inflammatory conditions and pain.

**Current Research:**

Limited research has been published specifically on 1-[[oxo(3-pyridinyl)methyl]amino]-3-(4-propan-2-ylphenyl)thiourea. However, its structural features suggest potential for pharmacological activity, making it an interesting target for further investigation.

**Note:** It's important to remember that this compound is still under investigation, and its efficacy and safety in humans have not been fully established. Further research is needed to determine its potential as a therapeutic agent.